Target Relevance

Molecular Definition

Canonical SMILES OCC(O)CSc1ccc(c2nonc12)[N+](=O)[O-]
Formula C9H9N3O5S
Molecular Weight 271.25 da
Stereocenters 0/1