Target Relevance

Molecular Definition

Canonical SMILES OCCNC(=O)CCSc1ccc(c2nonc12)[N+](=O)[O-]
Formula C11H12N4O5S
Molecular Weight 312.30 da
Stereocenters 0/0