Target Relevance

Molecular Definition

Canonical SMILES CC(=O)NCCSc1ccc(c2nonc12)[N+](=O)[O-]
Formula C10H10N4O4S
Molecular Weight 282.28 da
Stereocenters 0/0