Molecular Definition

Canonical SMILES CN(C)CCNC(=O)c1ccc(Sc2ccc(c3nonc23)[N+](=O)[O-])cc1
Formula C17H17N5O4S
Molecular Weight 387.41 da
Stereocenters 0/0