Molecular Definition

Canonical SMILES CONC(=O)c1ccc(Sc2ccc(c3nonc23)[N+](=O)[O-])cc1
Formula C14H10N4O5S
Molecular Weight 346.32 da
Stereocenters 0/0