Molecular Definition

Canonical SMILES CN(C)C(=O)c1ccc(Sc2ccc(c3nonc23)[N+](=O)[O-])cc1
Formula C15H12N4O4S
Molecular Weight 344.35 da
Stereocenters 0/0