Molecular Definition

Canonical SMILES NC(=O)c1ccc(Sc2ccc(c3nonc23)[N+](=O)[O-])cc1
Formula C13H8N4O4S
Molecular Weight 316.29 da
Stereocenters 0/0