Target Relevance

Molecular Definition

Canonical SMILES CCOC(=O)c1ccc(Sc2ccc(c3nonc23)[N+](=O)[O-])cc1
Formula C15H11N3O5S
Molecular Weight 345.33 da
Stereocenters 0/0