Target Relevance

Molecular Definition

Canonical SMILES Clc1ccc(CC(=O)N2Sc3ccccc3C2=O)cc1
Formula C15H10ClNO2S
Molecular Weight 303.76 da
Stereocenters 0/0