Target Relevance

Molecular Definition

Canonical SMILES Fc1ccc(CC(=O)N2Sc3ccccc3C2=O)cc1
Formula C15H10FNO2S
Molecular Weight 287.31 da
Stereocenters 0/0