Molecular Definition

Canonical SMILES SCCCCC[C@H](NC(=O)[C@@H]1CCCC(=O)N1)C(=O)NCc2cccc(OCc3ccccc3)c2
Formula C27H35N3O4S
Molecular Weight 497.65 da
Stereocenters 2/2