Target Relevance

Molecular Definition

Canonical SMILES CC(C)OC(=O)c1cccc(CC(=O)N2CCNc3nc(ccc3[C@H]2CC(=O)O)C(F)(F)F)c1
Formula C23H24F3N3O5
Molecular Weight 479.45 da
Stereocenters 1/1