Target Relevance

Molecular Definition

Canonical SMILES OC(=O)C[C@H]1N(CCNc2nc(ccc12)C(F)(F)F)C(=O)Cc3cccc(OC(=O)CC4CC4)c3
Formula C24H24F3N3O5
Molecular Weight 491.46 da
Stereocenters 1/1