Molecular Definition

Canonical SMILES Cc1ccc2c(NS(=O)(=O)c3ccccc3Cl)cccc2c1Oc4ncccc4c5ccnc(N[C@H]6CCCNC6)n5
Formula C31H29ClN6O3S
Molecular Weight 601.12 da
Stereocenters 1/1