Molecular Definition

Canonical SMILES Cc1ccc2c(NS(=O)(=O)c3ccccc3Cl)cccc2c1Oc4ncccc4c5ccnc(N[C@@H]6CC[C@@H](N)CC6)n5
Formula C32H31ClN6O3S
Molecular Weight 615.15 da
Stereocenters 2/2