Molecular Definition

Canonical SMILES Cc1cc(NS(=O)(=O)c2ccccc2C#N)c3ccccc3c1Oc4ncccc4c5ccnc(N[C@@H]6CC[C@@H](N)CC6)n5
Formula C33H31N7O3S
Molecular Weight 605.71 da
Stereocenters 2/2