Molecular Definition

Canonical SMILES Cc1cc(Nc2oc3ccccc3n2)c4ccccc4c1Oc5ncccc5c6ccnc(N[C@@H]7CC[C@@H](N)CC7)n6
Formula C33H31N7O2
Molecular Weight 557.64 da
Stereocenters 2/2