Molecular Definition

Canonical SMILES Cc1cc(Nc2nc3ccccc3[nH]2)c4ccccc4c1Oc5ncccc5c6ccnc(N[C@@H]7CC[C@@H](N)CC7)n6
Formula C33H32N8O
Molecular Weight 556.66 da
Stereocenters 2/2