Molecular Definition

Canonical SMILES N[C@@H]1CC[C@H](CC1)Nc2nccc(n2)c3cccnc3Oc4ccc(Nc5nc6ccccc6[nH]5)c7ccccc47
Formula C32H30N8O
Molecular Weight 542.63 da
Stereocenters 2/2