Molecular Definition

Canonical SMILES C1CNC[C@H](C1)Nc2nccc(n2)c3cccnc3Oc4ccc(Nc5nc6ccccc6[nH]5)c7ccccc47
Formula C31H28N8O
Molecular Weight 528.61 da
Stereocenters 1/1