Molecular Definition

Canonical SMILES CCN1C(=Nc2cc(CNc3cccnc3)sc2C1=O)NC4CCCC4
Formula C19H23N5OS
Molecular Weight 369.48 da
Stereocenters 0/0