Molecular Definition

Canonical SMILES CC(C)[C@H]1NC(=O)C[C@@H](C\C=C/CCC(=O)O)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H](C)NC1=O
Formula C26H36N4O6
Molecular Weight 500.59 da
Stereocenters 4/4