Target Relevance

Molecular Definition

Canonical SMILES N[C@@H](CO)COc1cc(Cl)c(cc1F)c2onc(n2)N3CCN(CC3)C(=O)c4ccccn4
Formula C21H22ClFN6O4
Molecular Weight 476.89 da
Stereocenters 1/1