Molecular Definition

Canonical SMILES COc1ncc(c(OC)n1)c2ccc3c(Nc4cc(Oc5cc(F)cc(F)c5)cc(c4)C(=O)O)c(cnc3c2)S(=O)(=O)NC6CC6
Formula C31H25F2N5O7S
Molecular Weight 649.62 da
Stereocenters 0/0