Molecular Definition

Canonical SMILES ONC(=O)CCCCc1ccn(n1)c2ccccc2
Formula C14H17N3O2
Molecular Weight 259.30 da
Stereocenters 0/0