Molecular Definition

Canonical SMILES COc1ccc(\C=C\C(=O)C[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)cc1OC
Formula C18H24O8
Molecular Weight 368.38 da
Stereocenters 5/5