Molecular Definition

Canonical SMILES CCc1c(Cc2ccccc2c3ccccc3)n4cccc(OCC(=O)O)c4c1C(=O)C(=O)N
Formula C27H24N2O5
Molecular Weight 456.49 da
Stereocenters 0/0