Target Relevance

Molecular Definition

Canonical SMILES Fc1ccc2c(c1)c(cn2C(=O)c3ccccc3)C4=CCNCC4
Formula C20H17FN2O
Molecular Weight 320.36 da
Stereocenters 0/0