Molecular Definition

Canonical SMILES O=C(c1cn[nH]c1)c2cc3c(Nc4ccncc4)ncnn3c2
Formula C15H11N7O
Molecular Weight 305.29 da
Stereocenters 0/0