Molecular Definition

Canonical SMILES O=C(c1cocc1)c2cc3c(Nc4ccncc4)ncnn3c2
Formula C16H11N5O2
Molecular Weight 305.29 da
Stereocenters 0/0