Molecular Definition

Canonical SMILES N(c1ccncc1)c2ncnn3cc(cc23)c4ccccc4
Formula C17H13N5
Molecular Weight 287.32 da
Stereocenters 0/0