Target Relevance

Molecular Definition

Canonical SMILES CCCC(=O)c1cnn(c1C)c2ccc(NC(=O)c3cn(CC(=O)N4CCN(C)CC4)c5cc(Cl)c(Cl)cc35)cc2
Formula C30H32Cl2N6O3
Molecular Weight 595.52 da
Stereocenters 0/0