Molecular Definition

Canonical SMILES Cl.C[C@@H](NS(=O)(=O)C)c1ccc(CNCC2COc3ccccc3N2)cc1
Formula C19H26ClN3O3S
Molecular Weight 411.95 da
Stereocenters 1/2