Target Relevance

Molecular Definition

Canonical SMILES CCCC(=O)c1cnn(c1C)c2ccc(NC(=O)c3cn(CC(=O)N4CCC(C4)NC)c5ccc(C)cc35)cc2
Formula C31H36N6O3
Molecular Weight 540.66 da
Stereocenters 0/1