Target Relevance

Molecular Definition

Canonical SMILES CCCC(=O)c1cnn(c1C)c2ccc(NC(=O)c3cn(CC(=O)N4CCCN(C)CC4)c5ccc(C)cc35)cc2
Formula C32H38N6O3
Molecular Weight 554.68 da
Stereocenters 0/0