Molecular Definition

Canonical SMILES O[C@@H](CN[C@H]1CCC[C@H]1C2CCCCC2)c3ccc(O)c4NC(=O)Sc34
Formula C20H28N2O3S
Molecular Weight 376.51 da
Stereocenters 3/3