Target Relevance

Molecular Definition

Canonical SMILES CCOC(=O)N1CCN(CC1)C(=O)[C@H](CCC(=O)O)NC(=O)c2cc(nc(n2)c3ccccc3)N4CCOCC4
Formula C27H34N6O7
Molecular Weight 554.59 da
Stereocenters 1/1