Molecular Definition

Canonical SMILES OC(=O)c1ccc(nc1)c2ccc(cn2)C(=O)O
Formula C12H8N2O4
Molecular Weight 244.20 da
Stereocenters 0/0