Molecular Definition

Canonical SMILES CC1(C)CCc2cc(ccc2O1)S(=O)(=O)N(CC(=O)O)Cc3ccc(Oc4ccccc4)cc3
Formula C26H27NO6S
Molecular Weight 481.56 da
Stereocenters 0/0