Molecular Definition

Canonical SMILES COc1cccc(c1)c2cnc3[nH]cc(c4ccc(OC)c(OC)c4)c3c2
Formula C22H20N2O3
Molecular Weight 360.41 da
Stereocenters 0/0