Molecular Definition

Canonical SMILES Cc1ccccc1c2ccc(cc2)C(=O)N3CCN(CC3)c4ncccn4
Formula C22H22N4O
Molecular Weight 358.44 da
Stereocenters 0/0