Molecular Definition

Canonical SMILES CCCCCCC(Sc1nc(Cl)cc(Nc2ccc(Nc3ccccc3)cc2)n1)C(=O)O
Formula C24H27ClN4O2S
Molecular Weight 471.02 da
Stereocenters 0/1