Molecular Definition

Canonical SMILES N[C@@H](CN1N=C(Br)C(=O)NC1=O)C(=O)O
Formula C6H7BrN4O4
Molecular Weight 279.05 da
Stereocenters 1/1