Target Relevance

Molecular Definition

Canonical SMILES COC(=O)COc1cccn2c(Cc3ccccc3c4ccccc4)c(C5CCCC5)c(C(=O)C(=O)N)c12
Formula C31H30N2O5
Molecular Weight 510.58 da
Stereocenters 0/0