Target Relevance

Molecular Definition

Canonical SMILES CC[C@H](\C=C\[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C[C@@H](O)[C@@]4(O)C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OCC(=O)N5CCOCC5)C(C)C
Formula C35H59NO5
Molecular Weight 573.85 da
Stereocenters 11/11