Target Relevance

Molecular Definition

Canonical SMILES CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3[C@@H](O)C=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OCC(=O)N5CCOCC5
Formula C33H55NO4
Molecular Weight 529.79 da
Stereocenters 9/9