Target Relevance

Molecular Definition

Canonical SMILES CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](CC[C@]12C)[C@@]4(C)CC[C@@H](CC4=CC3=O)OCC(=O)N5CCOCC5
Formula C33H53NO4
Molecular Weight 527.78 da
Stereocenters 8/8