Target Relevance

Molecular Definition

Canonical SMILES Oc1ccccc1C(=O)c2cc(Br)ccc2O
Formula C13H9BrO3
Molecular Weight 293.11 da
Stereocenters 0/0