Target Relevance

Molecular Definition

Canonical SMILES Oc1ccccc1C(=NNC(=O)c2ccccc2)c3ccccc3O
Formula C20H16N2O3
Molecular Weight 332.35 da
Stereocenters 0/0