Molecular Definition

Canonical SMILES NC(=N)c1ccc2[nH]c(cc2c1)c3cc(Br)cc(Br)c3O
Formula C15H11Br2N3O
Molecular Weight 409.08 da
Stereocenters 0/0